|
|
| | 2-(2-Methylphenyl)quinoline-4-carboxylic acid Basic information |
| Product Name: | 2-(2-Methylphenyl)quinoline-4-carboxylic acid | | Synonyms: | 2-(2-Methylphenyl)-4-quinolinecarboxylic acid;2-(2-methylphenyl)cinchoninic acid;BIM-0046527.P001;CBMicro_046414;2-(2-methylphenyl)quinoline-4-carboxylic acid(SALTDATA: FREE);4-Quinolinecarboxylic acid, 2-(2-Methylphenyl)-;IVK/9098937;Oprea1_115199 | | CAS: | 174636-85-2 | | MF: | C17H13NO2 | | MW: | 263.29 | | EINECS: | | | Product Categories: | | | Mol File: | 174636-85-2.mol |  |
| | 2-(2-Methylphenyl)quinoline-4-carboxylic acid Chemical Properties |
| Melting point | >220°C (dec.) | | Boiling point | 447.1±33.0 °C(Predicted) | | density | 1.248±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | DMSO (Sparingly), Methanol (Slightly, Sonicated) | | pka | 0.96±0.10(Predicted) | | form | Solid | | color | Light Orange to Orange | | InChI | 1S/C17H13NO2/c1-11-6-2-3-7-12(11)16-10-14(17(19)20)13-8-4-5-9-15(13)18-16/h2-10H,1H3,(H,19,20) | | InChIKey | YLQGICXPTGQXFS-UHFFFAOYSA-N | | SMILES | CC1=C(C=CC=C1)C2=CC(C(O)=O)=C3C(C=CC=C3)=N2 |
| Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-(2-Methylphenyl)quinoline-4-carboxylic acid Usage And Synthesis |
| | 2-(2-Methylphenyl)quinoline-4-carboxylic acid Preparation Products And Raw materials |
|