|
|
| | 3-Methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine Basic information |
| Product Name: | 3-Methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine | | Synonyms: | 3-methyl-5H,6H,7H,8H-[1,2,4]triazolo[4,3-a]pyrazine;1,2,4-Triazolo[4,3-a]pyrazine, 5,6,7,8-tetrahydro-3-methyl-;5,6,7,8-TETRAHYDRO-3-METHYL-1,2,4-TRIAZOLO[4,3-A]PYRAZINE,;3-Methyl-5,6,7,8-tetrahyd...;5,6,7,8-Tetrahydro-3-methyl-1,2,4-triazolo[4,3-a]pyrazine, CAS 886886-04-0;3-Methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine | | CAS: | 886886-04-0 | | MF: | C6H10N4 | | MW: | 138.17 | | EINECS: | | | Product Categories: | | | Mol File: | 886886-04-0.mol | ![3-Methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine Structure](CAS/GIF/886886-04-0.gif) |
| | 3-Methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine Chemical Properties |
| Boiling point | 340.7±52.0 °C(Predicted) | | density | 1.43±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 7.13±0.20(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C6H10N4/c1-5-8-9-6-4-7-2-3-10(5)6/h7H,2-4H2,1H3 | | InChIKey | WRGHYZWPWNOJEF-UHFFFAOYSA-N | | SMILES | C12=NN=C(C)N1CCNC2 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN2811 |
| | 3-Methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine Usage And Synthesis |
| Uses | 5,6,7,8-Tetrahydro-3-methyl-1,2,4-triazolo[4,3-a]pyrazine is used as a reagent to synthesize pyrrolo[2,3-b]pyridine compounds which have the potential to act as antiviral agents against specific viruses of the retrovirus family (such as the human immunodeficiency virus [HIV]). |
| | 3-Methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine Preparation Products And Raw materials |
|