| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-(tert-Butoxycarbonyl)-3-azaspiro[5.5]undecane-9-carboxylic acid Basic information |
| Product Name: | 3-(tert-Butoxycarbonyl)-3-azaspiro[5.5]undecane-9-carboxylic acid | | Synonyms: | 3-Boc-3-azaspiro[5.5]undecane-9-carboxylic acid;3-t-Butyloxycarbonyl-3-azaspiro[5.5]undecane-9-carboxylic acid;9-tert-Butoxycarbonyl-9-azaspiro[5.5]undecane-3-carboxylic acid;3-Azaspiro[5.5]undecane-3,9-dicarboxylic acid 3-(tert-butyl) ester - A6004;3-Azaspiro[5.5]undecane-3,9-dicarboxylic acid, 3-(1,1-dimethylethyl) ester;3-Azaspiro[5.5]undecane-3,9-dicarboxylic acid, 3-(1,1-dimeth...;N-Boc-3-azaspiro[5.5]undecane-9-carboxylic acid;3-Azaspiro[5.5]undecane-3,9-dicarboxylic acid 3-(tert-butyl)ester 95+% | | CAS: | 170228-81-6 | | MF: | C16H27NO4 | | MW: | 297.39 | | EINECS: | | | Product Categories: | | | Mol File: | 170228-81-6.mol | ![3-(tert-Butoxycarbonyl)-3-azaspiro[5.5]undecane-9-carboxylic acid Structure](CAS/GIF/170228-81-6.gif) |
| | 3-(tert-Butoxycarbonyl)-3-azaspiro[5.5]undecane-9-carboxylic acid Chemical Properties |
| Boiling point | 435.3±45.0 °C(Predicted) | | density | 1.14±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 4.75±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C16H27NO4/c1-15(2,3)21-14(20)17-10-8-16(9-11-17)6-4-12(5-7-16)13(18)19/h12H,4-11H2,1-3H3,(H,18,19) | | InChIKey | ZDWMIWSOZZMELY-UHFFFAOYSA-N | | SMILES | C1C2(CCC(C(O)=O)CC2)CCN(C(OC(C)(C)C)=O)C1 |
| | 3-(tert-Butoxycarbonyl)-3-azaspiro[5.5]undecane-9-carboxylic acid Usage And Synthesis |
| | 3-(tert-Butoxycarbonyl)-3-azaspiro[5.5]undecane-9-carboxylic acid Preparation Products And Raw materials |
|