|
|
| | (3E)-4,8-dimethylnona-1,3,7-triene Basic information |
| Product Name: | (3E)-4,8-dimethylnona-1,3,7-triene | | Synonyms: | (3E)-4,8-dimethylnona-1,3,7-triene;(E)-4,8-Dimethyl-1,3,7-nonatriene;1,3,7-Nonatriene,4,8-diMethyl-, (3E)-;(3E)-4,8-dimethyl-1,3,7-nonatriene (DMNT);(3E)-4,8-Dimethyl-1,3,7-nonatriene;(E)-4,8-dimethylnona-1,3,7-triene | | CAS: | 19945-61-0 | | MF: | C11H18 | | MW: | 150.26 | | EINECS: | | | Product Categories: | | | Mol File: | 19945-61-0.mol |  |
| | (3E)-4,8-dimethylnona-1,3,7-triene Chemical Properties |
| Boiling point | 81 °C(Press: 18 Torr) | | density | 0.782±0.06 g/cm3(Predicted) | | solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Stability: | Hygroscopic, Light sensitive | | InChI | InChI=1S/C11H18/c1-5-7-11(4)9-6-8-10(2)3/h5,7-8H,1,6,9H2,2-4H3/b11-7+ | | InChIKey | LUKZREJJLWEWQM-YRNVUSSQSA-N | | SMILES | C=C/C=C(\C)/CC/C=C(/C)\C |
| | (3E)-4,8-dimethylnona-1,3,7-triene Usage And Synthesis |
| Uses | 4,8-Dimethyl-1,3(E),7-nonatriene is a volatile compound released by corn plants in response to predation. | | Definition | ChEBI: An alkatriene consisting of 4,8-dimethylnonane having the three double bonds in the 1-, 3- and 7-positions. | | Synthesis Reference(s) | Journal of the American Chemical Society, 100, p. 2254, 1978 DOI: 10.1021/ja00475a059
Tetrahedron Letters, 35, p. 5453, 1994 DOI: 10.1016/S0040-4039(00)73523-4 |
| | (3E)-4,8-dimethylnona-1,3,7-triene Preparation Products And Raw materials |
|