|
|
| | 6-Chloro-2-benzoxazolethiol Basic information |
| Product Name: | 6-Chloro-2-benzoxazolethiol | | Synonyms: | 2-MERCAPTO-6-CHLOROBENZOXAZOLE;6-CHLORO-BENZOOXAZOLE-2-THIOL;6-CHLORO-2-BENZOXAZOLETHIOL;6-CHLORO-2-MERCAPTOBENZOXAZOLE;6-chlorobenzoxazole-2(3H)-thione;6-Chloro-3H-benzoxazole-2-thione;6-Chlorbenzoxazol-2(3H)-thion;6-CHLORO-2-BENZOXAZOLETHIOL 99% | | CAS: | 22876-20-6 | | MF: | C7H4ClNOS | | MW: | 185.63 | | EINECS: | 245-282-8 | | Product Categories: | Oxazole&Isoxazole;1 | | Mol File: | 22876-20-6.mol |  |
| | 6-Chloro-2-benzoxazolethiol Chemical Properties |
| Melting point | 229-232 °C | | Boiling point | 288.9±42.0 °C(Predicted) | | density | 1.2291 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | 2-8°C, stored under nitrogen | | form | Crystalline Powder or Needles | | pka | 10.23±0.20(Predicted) | | color | Yellow to beige | | InChI | InChI=1S/C7H4ClNOS/c8-4-1-2-5-6(3-4)10-7(11)9-5/h1-3H,(H,9,11) | | InChIKey | HAASPZUBSZGCKU-UHFFFAOYSA-N | | SMILES | O1C2=CC(Cl)=CC=C2NC1=S |
| Safety Statements | 24/25 | | HazardClass | IRRITANT | | HS Code | 29349990 |
| | 6-Chloro-2-benzoxazolethiol Usage And Synthesis |
| Chemical Properties | yellow to beige crystalline powder or needles | | Uses | 6-Chloro-2(3H)-benzoxazolethione is used as a reactant in the synthesis of disulfide bond-containing ajoene analogs as quorum sensing inhibitors. |
| | 6-Chloro-2-benzoxazolethiol Preparation Products And Raw materials |
|