| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,9-Diphenyl-1,3,6,8-nonatetraen-5-one Basic information |
| Product Name: | 1,9-Diphenyl-1,3,6,8-nonatetraen-5-one | | Synonyms: | 6,8-nonatetraen-5-one,1,9-diphenyl-3;DICINNAMYLIDENEACETONE;1,9-diphenylnona-1,3,6,8-tetraen-5-one;(1Z,3E,6E,8E)-1,9-diphenyl-5-nona-1,3,6,8-tetraenone;1,9-Diphenyl-1,3,6,8-nonatetraen-5-one,97%;1,9-Diphenyl-1,3,6,8-nonatetraen-5-one,98%;1,9-DIPHENYL-1,3,6,8;1,9-Diphenyl-1,3,6,8-nonatetraen-5-one, 97% 5GR | | CAS: | 622-21-9 | | MF: | C21H18O | | MW: | 286.37 | | EINECS: | 210-724-0 | | Product Categories: | | | Mol File: | 622-21-9.mol |  |
| | 1,9-Diphenyl-1,3,6,8-nonatetraen-5-one Chemical Properties |
| Melting point | 144-145 °C (lit.) | | Boiling point | 388.73°C (rough estimate) | | density | 1.0402 (rough estimate) | | refractive index | 1.4880 (estimate) | | form | powder to crystal | | color | Light yellow to Yellow to Orange | | InChI | 1S/C21H18O/c22-21(17-9-7-15-19-11-3-1-4-12-19)18-10-8-16-20-13-5-2-6-14-20/h1-18H/b15-7+,16-8+,17-9+,18-10+ | | InChIKey | RLJALOQFYHCJKG-FVRNMFRHSA-N | | SMILES | O=C(\C=C\C=C\c1ccccc1)/C=C/C=C/c2ccccc2 | | CAS DataBase Reference | 622-21-9(CAS DataBase Reference) | | EPA Substance Registry System | 1,3,6,8-Nonatetraen-5-one, 1,9-diphenyl- (622-21-9) |
| Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29141990 | | Storage Class | 11 - Combustible Solids |
| | 1,9-Diphenyl-1,3,6,8-nonatetraen-5-one Usage And Synthesis |
| Chemical Properties | yellow powder | | Uses | Dicinnamalacetone was used as an indicator in measuring the surface acidity of homoionic montmorillonites by titrating certain Hammett indicators adsorbed on the clay with n-butylamine. It was also used as an indicator (yellow to bright red) for detection of excess hydrogen halides in many organic solvents (except alcohols). | | Purification Methods | Crystallise the ketone from *benzene/isooctane (1:1). The 1,3,5-trinitrobenzene complex (1:1) has m 113o (from EtOH), and the 1,3,5-trinitrobenzene complex (1:2) has m 110o (from EtOH). [Beilstein 7 H 524, 7 I 293, 7 II 484, 7 III 2756, 7 IV 1834.] The 2,4-dinitrophenylhydrazone has m 199-200o. |
| | 1,9-Diphenyl-1,3,6,8-nonatetraen-5-one Preparation Products And Raw materials |
|