|
|
| | 2-methyl-2-(4-methylphenoxy)propanoic acid Basic information |
| Product Name: | 2-methyl-2-(4-methylphenoxy)propanoic acid | | Synonyms: | 2-methyl-2-(4-methylphenoxy)propanoic acid;2-methyl-2-(4-methylphenoxy)propanoic acid(SALTDATA: FREE);Propanoic acid, 2-Methyl-2-(4-Methylphenoxy)-;2-methyl-2-(4-methylphenoxy)propionic acid;Acide methyl-2 (p-methylphenoxy)-2 propionique [French];Propionic acid, 2-methyl-2-(p-tolyloxy)- | | CAS: | 23438-11-1 | | MF: | C11H14O3 | | MW: | 194.23 | | EINECS: | | | Product Categories: | | | Mol File: | 23438-11-1.mol |  |
| | 2-methyl-2-(4-methylphenoxy)propanoic acid Chemical Properties |
| Melting point | 73-74 °C | | Boiling point | 310.0±17.0 °C(Predicted) | | density | 1.116±0.06 g/cm3(Predicted) | | pka | 3.31±0.10(Predicted) | | form | solid | | InChI | 1S/C11H14O3/c1-8-4-6-9(7-5-8)14-11(2,3)10(12)13/h4-7H,1-3H3,(H,12,13) | | InChIKey | OQUCRQLGCRZSBH-UHFFFAOYSA-N | | SMILES | Cc1ccc(OC(C)(C)C(O)=O)cc1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 2-methyl-2-(4-methylphenoxy)propanoic acid Usage And Synthesis |
| Synthesis Reference(s) | Journal of the American Chemical Society, 91, p. 4782, 1969 DOI: 10.1021/ja01045a034 |
| | 2-methyl-2-(4-methylphenoxy)propanoic acid Preparation Products And Raw materials |
|