| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3-(5-Phenyl-1,3-oxazol-2-yl)propanoic acid Basic information |
| | 3-(5-Phenyl-1,3-oxazol-2-yl)propanoic acid Chemical Properties |
| Melting point | 149-153 °C | | form | solid | | InChI | 1S/C12H11NO3/c14-12(15)7-6-11-13-8-10(16-11)9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H,14,15) | | InChIKey | GFVIYHMHRMUSLA-UHFFFAOYSA-N | | SMILES | OC(=O)CCc1ncc(o1)-c2ccccc2 |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-41 | | Safety Statements | 26-36/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 3-(5-Phenyl-1,3-oxazol-2-yl)propanoic acid Usage And Synthesis |
| | 3-(5-Phenyl-1,3-oxazol-2-yl)propanoic acid Preparation Products And Raw materials |
|