| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:1-Benzyl-4-phenyl-1H-1,2,3-triazol-5-amine CAS:32515-07-4 Purity:>95% Package:1g, 5g, 500mg
|
| Company Name: |
Wuhan Chemwish Technology Co., Ltd
|
| Tel: |
86-027-67849912 |
| Email: |
sales@chemwish.com |
| Products Intro: |
Product Name:1-Benzyl-4-phenyl-1H-1,2,3-triazol-5-aMine CAS:32515-07-4 Purity:>95% Package:500Mg;1g;5g;25g;100g
|
|
| | 1-BENZYL-4-PHENYL-1H-1,2,3-TRIAZOL-5-AMINE Basic information |
| Product Name: | 1-BENZYL-4-PHENYL-1H-1,2,3-TRIAZOL-5-AMINE | | Synonyms: | 1-BENZYL-4-PHENYL-1H-1,2,3-TRIAZOL-5-AMINE;1-Benzyl-4-phenyl-1H-1,2,3-triazol-5-amine 95%;3-BENZYL-5-PHENYL-3H-[1,2,3]-TRIAZOL-4-YLAMINE;1H-1,2,3-Triazol-5-amine, 4-phenyl-1-(phenylmethyl)- | | CAS: | 32515-07-4 | | MF: | C15H14N4 | | MW: | 250.3 | | EINECS: | | | Product Categories: | | | Mol File: | 32515-07-4.mol |  |
| | 1-BENZYL-4-PHENYL-1H-1,2,3-TRIAZOL-5-AMINE Chemical Properties |
| Melting point | 158 | | InChI | 1S/C15H14N4/c16-15-14(13-9-5-2-6-10-13)17-18-19(15)11-12-7-3-1-4-8-12/h1-10H,11,16H2 | | InChIKey | JTJNNNCLXPPMNC-UHFFFAOYSA-N | | SMILES | Nc1c(nnn1Cc2ccccc2)-c3ccccc3 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 3 Oral |
| | 1-BENZYL-4-PHENYL-1H-1,2,3-TRIAZOL-5-AMINE Usage And Synthesis |
| | 1-BENZYL-4-PHENYL-1H-1,2,3-TRIAZOL-5-AMINE Preparation Products And Raw materials |
|