METHYL 4-CHLORO-2-NITROBENZOATE manufacturers
|
| | METHYL 4-CHLORO-2-NITROBENZOATE Basic information |
| | METHYL 4-CHLORO-2-NITROBENZOATE Chemical Properties |
| Melting point | 43-45 °C(lit.) | | Boiling point | 285.6±20.0 °C(Predicted) | | density | 1.426±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C8H6ClNO4/c1-14-8(11)6-3-2-5(9)4-7(6)10(12)13/h2-4H,1H3 | | InChIKey | JWOSXVMUUBWGOL-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=C(Cl)C=C1[N+]([O-])=O | | CAS DataBase Reference | 42087-80-9(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2916.39.7900 |
| | METHYL 4-CHLORO-2-NITROBENZOATE Usage And Synthesis |
| | METHYL 4-CHLORO-2-NITROBENZOATE Preparation Products And Raw materials |
|