| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
METHYL 3-HYDROXYDECANOATE manufacturers
|
| | METHYL 3-HYDROXYDECANOATE Basic information |
| | METHYL 3-HYDROXYDECANOATE Chemical Properties |
| Boiling point | 294.7±13.0 °C(Predicted) | | density | 0.956±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | pka | 13.98±0.20(Predicted) | | color | Colourless | | InChI | InChI=1S/C11H22O3/c1-3-4-5-6-7-8-10(12)9-11(13)14-2/h10,12H,3-9H2,1-2H3 | | InChIKey | UBVACUZVNTVHTE-UHFFFAOYSA-N | | SMILES | C(O)(CCCCCCC)CC(=O)OC |
| | METHYL 3-HYDROXYDECANOATE Usage And Synthesis |
| Uses | 3-Hydroxydecanoic Acid Methyl Ester is a 3-hydroxy free fatty acid ester, a common component of biodiesel. 3-Hydroxydecanoic Acid Methyl Ester is the methyl ester analogue of the antibacterial agent, Myrmicacin (H933950). |
| | METHYL 3-HYDROXYDECANOATE Preparation Products And Raw materials |
|