|
|
| | 4-Hexenoic acid, 3-(aminomethyl)-5-methyl- Basic information |
| | 4-Hexenoic acid, 3-(aminomethyl)-5-methyl- Chemical Properties |
| Melting point | >151°C (dec.) | | Boiling point | 284.1±33.0 °C(Predicted) | | density | 1.029±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Methanol (Slightly, Heated, Sonicated), Water (Slightly) | | form | Solid | | pka | 4.35±0.10(Predicted) | | color | White to Light Beige | | Stability: | Hygroscopic | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C8H15NO2/c1-6(2)3-7(5-9)4-8(10)11/h3,7H,4-5,9H2,1-2H3,(H,10,11) | | InChIKey | RILHQHHDJPATCS-UHFFFAOYSA-N | | SMILES | C(O)(=O)CC(CN)/C=C(\C)/C |
| Storage Class | 11 - Combustible Solids |
| | 4-Hexenoic acid, 3-(aminomethyl)-5-methyl- Usage And Synthesis |
| Chemical Properties | Pale Beige Solid | | Uses | 4,5-Dehydropregabalin is an impurity of the anticonvulsant, Pregabalin (P704800). |
| | 4-Hexenoic acid, 3-(aminomethyl)-5-methyl- Preparation Products And Raw materials |
|