| Company Name: |
nantong honglong Gold |
| Tel: |
13078814179 13078814179 |
| Email: |
2771867773@qq.com |
|
| Product Name: | 1,4,5,8-Tetrachloroanthraquinone | | Synonyms: | TCAQ - 1,4,5,8-tetrachloroanthraquinone;1,4,5,8-tetrachloro-10-anthracenedione;10-Anthracenedione,1,4,5,8-tetrachloro-9;1,4,5,8-tetrachloro-9,10-Anthracenedione;1,4,5,8-tetrachloro-9,10-anthraquinone;8-Tetrachloroanthraquinone;1,4,5,8-TETRACHLOROANTHRAQUINONE;1,4,5,8-tetrachloroanthracene-9,10-dione | | CAS: | 81-58-3 | | MF: | C14H4Cl4O2 | | MW: | 345.99 | | EINECS: | 201-362-4 | | Product Categories: | Intermediates of Dyes and Pigments;11 | | Mol File: | 81-58-3.mol |  |
| | 1,4,5,8-Tetrachloroanthraquinone Chemical Properties |
| Melting point | 342°C(lit.) | | Boiling point | 510.7±50.0 °C(Predicted) | | density | 1.672±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly, Heated), DMSO (Slightly, Heated), Pyridine (Slightly, Heat | | form | Solid | | color | Pale Yellow to Light Yellow | | InChI | InChI=1S/C14H4Cl4O2/c15-5-1-2-6(16)10-9(5)13(19)11-7(17)3-4-8(18)12(11)14(10)20/h1-4H | | InChIKey | DUJPMUKIEFLXRE-UHFFFAOYSA-N | | SMILES | C1(Cl)=C2C(C(=O)C3=C(C2=O)C(Cl)=CC=C3Cl)=C(Cl)C=C1 | | CAS DataBase Reference | 81-58-3(CAS DataBase Reference) | | EPA Substance Registry System | 9,10-Anthracenedione, 1,4,5,8-tetrachloro- (81-58-3) |
| TSCA | TSCA listed | | HS Code | 2914.79.3000 |
| | 1,4,5,8-Tetrachloroanthraquinone Usage And Synthesis |
| Physical Form | solid | | Uses | 1,4,5,8-Tetrachloroanthraquinone is an intermediate used to prepare trianthrimides as potential high-performance pigments. It can also be used to synthesize γ-aminobutyric acid analogs as novel potent GABA-AT (γ-aminobutyrate aminotransferase) inhibitors. | | Synthesis | Method 1: Put 3000kg of 20% fuming sulfuric acid in chlorination pot, start stirring, then add 250kg anthraquinone, warm up to 90-100, continue stirring to dissolve for 1 hour and then add 1kg of iodine of locator agent, after that, pass into chlorine, the temperature of chlorine pass is controlled at 50-150, the reaction is for 100-200 hours, then add 1000kg of 92.5% sulfuric acid to dilute it, filter and Acid washing, then water washing to neutral, drying to get tetrachloroanthraquinone to be used;
|
| | 1,4,5,8-Tetrachloroanthraquinone Preparation Products And Raw materials |
|