- 6-Dehydroprogesterone
-
- $0.00 / 1kg
-
2026-01-16
- CAS:1162-56-7
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 1000kg
- Dehydroprogesterone
-
- $0.00 / 1kg
-
2025-12-25
- CAS:1162-56-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 2550kg
|
| | Pregna-4,6-diene-3,20-dione Basic information | | Uses |
| Product Name: | Pregna-4,6-diene-3,20-dione | | Synonyms: | 4,6-PREGNADIEN-3,20-DIONE;6-DEHYDROPROGESTERONE;6-Dehydropprogesterone;6- dehydrogenase Progesterone;Progesterone Derivatives;DELTA-6-PROGESTERONE;PREGNA-4,6-DIENE-3,20-DIONE;Dehydroprogesterone | | CAS: | 1162-56-7 | | MF: | C21H28O2 | | MW: | 312.45 | | EINECS: | 1533716-785-6 | | Product Categories: | | | Mol File: | 1162-56-7.mol |  |
| | Pregna-4,6-diene-3,20-dione Chemical Properties |
| Melting point | 147-148 °C(Solv: hexane (110-54-3)) | | Boiling point | 462.8±45.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | color | White to Off-White | | InChI | InChI=1S/C21H28O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h4-5,12,16-19H,6-11H2,1-3H3/t16-,17+,18-,19-,20-,21+/m0/s1 | | InChIKey | JGMOKGBVKVMRFX-LEKSSAKUSA-N | | SMILES | C1(=O)C=C2[C@](C)(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1)(C)[C@@H](C(=O)C)CC3)C=C2 | | CAS DataBase Reference | 1162-56-7(CAS DataBase Reference) |
| | Pregna-4,6-diene-3,20-dione Usage And Synthesis |
| Uses | 6-Dehydroprogesterone is an impurity found in progesterone. | | Uses | 6-Dehydroprogesterone is an impurity found in progesterone (P755900). |
| | Pregna-4,6-diene-3,20-dione Preparation Products And Raw materials |
|