3-methoxy-9H-carbazole manufacturers
|
| | 3-methoxy-9H-carbazole Basic information |
| | 3-methoxy-9H-carbazole Chemical Properties |
| Melting point | 138-139 °C | | Boiling point | 392.2±15.0 °C(Predicted) | | density | 1.232±0.06 g/cm3(Predicted) | | pka | 17.55±0.30(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C13H11NO/c1-15-9-6-7-13-11(8-9)10-4-2-3-5-12(10)14-13/h2-8,14H,1H3 | | InChIKey | BISIQSCKDZYPLR-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C2=C1C=CC(OC)=C2 |
| HazardClass | IRRITANT | | HS Code | 2933998090 |
| | 3-methoxy-9H-carbazole Usage And Synthesis |
| Uses | 3-Methoxy-9H-Carbazole induces caspase-3 activities and the cellular generation of eactive oxygen species. 3-Methoxy-9H-Carbazole inhibits cancer cell proliferation and induces apoptosis[1]. | | Definition | ChEBI: 3-methoxy-9H-carbazole is a member of carbazoles. | | References | [1] Alanazi J, et al. 3-Methoxy Carbazole Impedes the Growth of Human Breast Cancer Cells by Suppressing NF-κB Signaling Pathway. Pharmaceuticals (Basel). 2022 Nov 14;15(11):1410. DOI:10.3390/ph15111410 |
| | 3-methoxy-9H-carbazole Preparation Products And Raw materials |
|