|
|
| | 3,6-diMethoxy-9H-carbazole Basic information | | Application |
| Product Name: | 3,6-diMethoxy-9H-carbazole | | Synonyms: | 3,6-Dimethoxycarbazole;3,6-diMethoxy-9H-carbazole;3,6-DIMETHOXY-9H-CARBAZOLE(WX145603);9H-Carbazole, 3,6-dimethoxy-;SKL084;Carprofen Impurity 18 | | CAS: | 57103-01-2 | | MF: | C14H13NO2 | | MW: | 227.26 | | EINECS: | | | Product Categories: | | | Mol File: | 57103-01-2.mol |  |
| | 3,6-diMethoxy-9H-carbazole Chemical Properties |
| Melting point | 131-133 °C | | Boiling point | 426.7±25.0 °C(Predicted) | | density | 1.235±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 17.26±0.30(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C14H13NO2/c1-16-9-3-5-13-11(7-9)12-8-10(17-2)4-6-14(12)15-13/h3-8,15H,1-2H3 | | InChIKey | YQKMWXHJSIEAEX-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(OC)C=C2)C2=C1C=CC(OC)=C2 | | CAS DataBase Reference | 57103-01-2 |
| | 3,6-diMethoxy-9H-carbazole Usage And Synthesis |
| Application | 3,6-Dimethoxy-9H-carbazole can be used as an organic intermediate and a pharmaceutical intermediate, mainly in laboratory research and development processes and chemical and pharmaceutical analysis processes. | | Definition | ChEBI: 3,6-dimethoxy-9H-carbazole is a member of carbazoles. |
| | 3,6-diMethoxy-9H-carbazole Preparation Products And Raw materials |
|