3-Amino-5-(4-methoxyphenyl)thiophene-2-carboxylic acid methyl ester manufacturers
|
| | 3-Amino-5-(4-methoxyphenyl)thiophene-2-carboxylic acid methyl ester Basic information |
| Product Name: | 3-Amino-5-(4-methoxyphenyl)thiophene-2-carboxylic acid methyl ester | | Synonyms: | METHYL 3-AMINO-5-(4-METHOXYPHENYL)THIOPHENE-2-CARBOXYLATE;3-AMINO-5-(4-METHOXYPHENYL)THIOPHENE-2-CARBOXYLIC ACID METHYL ESTER;3-AMino-5-(4-Methoxyphenyl)thiophene-2-carboxylicacidMethyleste;3-Amino-5-(4-methoxyphenyl)thiophene-2-carboxylic acid methyl es;3-amino-5-(4-methoxyphenyl)-2-thiophenecarboxylic acid;JR-9573, Methyl 3-amino-5-(4-methoxyphenyl)thiophene-2-carboxylate, 97%;3-Amino-5-(4-methoxyphenyl)thiophene-2-carboxylic acid methy...;, 3-amino-5-(4-methoxyphenyl)-2-Thiophenecarboxylic acid, methyl ester | | CAS: | 37572-23-9 | | MF: | C13H13NO3S | | MW: | 263.31 | | EINECS: | 201-215-5 | | Product Categories: | | | Mol File: | 37572-23-9.mol |  |
| | 3-Amino-5-(4-methoxyphenyl)thiophene-2-carboxylic acid methyl ester Chemical Properties |
| Melting point | 187-190°C | | Boiling point | 472.1±45.0 °C(Predicted) | | density | 1.263±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 1.82±0.10(Predicted) | | form | solid | | InChI | 1S/C13H13NO3S/c1-16-9-5-3-8(4-6-9)11-7-10(14)12(18-11)13(15)17-2/h3-7H,14H2,1-2H3 | | InChIKey | CBUIWNUZMRQRPZ-UHFFFAOYSA-N | | SMILES | O=C(OC)C1=C(N)C=C(C2=CC=C(OC)C=C2)S1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-Amino-5-(4-methoxyphenyl)thiophene-2-carboxylic acid methyl ester Usage And Synthesis |
| | 3-Amino-5-(4-methoxyphenyl)thiophene-2-carboxylic acid methyl ester Preparation Products And Raw materials |
|