| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Cyclohexene-d10
CAS:1603-55-0
Remarks:CS-C-01904
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Cyclohexene-d10
CAS:1603-55-0
Purity:98 atom % D Package:5G Remarks:480452-5G
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:Cyclohexene-d10 98 atom % D
CAS:1603-55-0
Purity:99% (CP) Package:5g Remarks:NULL
|
|
| | CYCLOHEXENE-D10 Basic information |
| | CYCLOHEXENE-D10 Chemical Properties |
| Melting point | -104 °C (lit.) | | Boiling point | 83 °C (lit.) | | density | 0.908 g/mL at 25 °C | | refractive index | n20/D 1.442(lit.) | | Fp | 10 °F | | solubility | Chloroform (Slightly), Hexanes (Slightly) | | form | Oil | | color | Colourless | | Stability: | Volatile | | InChI | 1S/C6H10/c1-2-4-6-5-3-1/h1-2H,3-6H2/i1D,2D,3D2,4D2,5D2,6D2 | | InChIKey | HGCIXCUEYOPUTN-KYJNQUCMSA-N | | SMILES | [2H]C1=C([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| | CYCLOHEXENE-D10 Usage And Synthesis |
| Uses | Cyclohexene-d10 is a labelled organic solvent. It has also been used in the synthesis of adipic acid. |
| | CYCLOHEXENE-D10 Preparation Products And Raw materials |
|