| Company Name: |
Cochemical Ltd. |
| Tel: |
029-86115547 17791676824 |
| Email: |
sales@cochemical.com |
|
| | Pyridine,5-hydrazinyl-2-(trifluoromethyl)- Basic information |
| | Pyridine,5-hydrazinyl-2-(trifluoromethyl)- Chemical Properties |
| storage temp. | 2-8°C | | form | solid | | color | Yellow | | InChI | InChI=1S/C6H6F3N3/c7-6(8,9)5-2-1-4(12-10)3-11-5/h1-3,12H,10H2 | | InChIKey | KLLXIDZXMUALHC-UHFFFAOYSA-N | | SMILES | C1(C(F)(F)F)=NC=C(NN)C=C1 |
| HazardClass | IRRITANT | | HS Code | 2933998090 |
| | Pyridine,5-hydrazinyl-2-(trifluoromethyl)- Usage And Synthesis |
| Uses | 5-Hydrazinyl-2-(trifluoromethyl)pyridine is a derivative of polycyclic heteroaromatic compounds. 5-Hydrazinyl-2-(trifluoromethyl)pyridine is useful as TRPA1 modulator and in the treatment of pains. |
| | Pyridine,5-hydrazinyl-2-(trifluoromethyl)- Preparation Products And Raw materials |
|