| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:Ethyl 6-(diethylphosphono)hexanoate
CAS:54965-29-6
Purity:97% Package:5G
|
| Company Name: |
Syntechem Co.,Ltd
|
| Tel: |
|
| Email: |
info@syntechem.com |
| Products Intro: |
Product Name:ethyl 6-(diethoxyphosphoryl)hexanoate
CAS:54965-29-6
Purity:97% Package:1g;5g;25g;100g;250g;1kg;5kg;10kg;25kg Remarks:we offer low price custom synthesis and contract manufacturing
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Ethyl 6-(diethylphosphono)hexanoate
CAS:54965-29-6
Purity:97% Package:5G Remarks:694002-5G
|
| Company Name: |
Changzhou Liren Medical Technology Co. Ltd.
|
| Tel: |
0519-85859058 13915836899 |
| Email: |
2078957504@qq.com |
| Products Intro: |
Product Name:6-(Diethylphosphono)-hexanoic acid ethyl ester
CAS:54965-29-6
Purity:99% Package:1kg，25kg，100kg
|
|
| | 6-(Diethylphosphono)-hexanoic acid ethyl ester Basic information |
| | 6-(Diethylphosphono)-hexanoic acid ethyl ester Chemical Properties |
| Boiling point | 114-118/0.3 mmHg | | density | 1.040 g/mL at 25 °C | | refractive index | n20/D 1.441 | | Fp | 110 °C | | form | liquid | | InChI | 1S/C12H25O5P/c1-4-15-12(13)10-8-7-9-11-18(14,16-5-2)17-6-3/h4-11H2,1-3H3 | | InChIKey | YFXDHFXPPUPIKR-UHFFFAOYSA-N | | SMILES | CCOC(=O)CCCCCP(=O)(OCC)OCC |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | 6-(Diethylphosphono)-hexanoic acid ethyl ester Usage And Synthesis |
| Uses | Ethyl 6-(Diethylphosphono)hexanoate is an essential oil component from the flowers of Alstonia scholaris in Bangladesh. |
| | 6-(Diethylphosphono)-hexanoic acid ethyl ester Preparation Products And Raw materials |
|