|
|
| | 2-Octen-1-ylsuccinic anhydride, mixture of cis and trans Basic information |
| Product Name: | 2-Octen-1-ylsuccinic anhydride, mixture of cis and trans | | Synonyms: | 2-Octenylsuccinic Anhydride (cis- and trans- mixture);2-Octenylsuccinic Anhydride ;2,5-Furandione, dihydro-3-(2-octen-1-yl)-;2-Octen-1-ylsuccinic anhydride, Mixture of cis and trans 97%;2-Octenylsuccinic Anhydride (cis- and trans- mixture);2-octen-1-ylsuccinic anhydride, mixture of cis and trans;2-Octenylsuccinic anhydride, 95%, mixture of cis and trans;2-OctenylsuccinicAnhydride(cis-andtrans-mixture)> | | CAS: | 42482-06-4 | | MF: | C12H18O3 | | MW: | 210.27 | | EINECS: | 629-679-7 | | Product Categories: | | | Mol File: | 42482-06-4.mol |  |
| | 2-Octen-1-ylsuccinic anhydride, mixture of cis and trans Chemical Properties |
| Melting point | 8-12°C (lit.) | | density | 1 g/mL at 25 °C(lit.) | | vapor pressure | 43.5Pa at 20℃ | | refractive index | n20/D1.4694(lit.) | | Fp | 113℃ | | form | Viscous | | color | Colorless to Almost colorless | | Boiling point | 168°C/10 mmHg(lit.) | | InChI | InChI=1S/C12H18O3/c1-2-3-4-5-6-7-8-10-9-11(13)15-12(10)14/h6-7,10H,2-5,8-9H2,1H3 | | InChIKey | WSGFXVFLWVXTCJ-UHFFFAOYSA-N | | SMILES | O1C(=O)CC(CC=CCCCCC)C1=O | | LogP | 4.68 at 22℃ and pH7 | | EPA Substance Registry System | 2,5-Furandione, dihydro-3-(2-octenyl)- (42482-06-4) |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29171900 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | 2-Octen-1-ylsuccinic anhydride, mixture of cis and trans Usage And Synthesis |
| Uses | 2-Octen-1-ylsuccinic anhydride, mixture of cis and trans can be used in food hydrocolloids.
| | Uses | 2-Octen-1-ylsuccinic anhydride, mixture of cis and trans can be used as a structural unit in organic synthesis for the manufacture of polyesters, polyurethanes and other polymers. In addition, it is used in the synthesis of surfactants, emulsifiers and other surfactant systems. | | Definition | ChEBI: Dihydro-3-(2-octenyl)-2,5-furandione is a dicarboxylic acid. |
| | 2-Octen-1-ylsuccinic anhydride, mixture of cis and trans Preparation Products And Raw materials |
|