| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (-)-MENTHYL CHLORIDE Basic information |
| Product Name: | (-)-MENTHYL CHLORIDE | | Synonyms: | L-(-)-MENTHYL CHLORIDE;L-MENTHYL CHLORIDE;(-)-3-CHLORO-P-MENTHANE;(1R)-(-)-MENTHYL CHLORIDE;(1S,2R,4R)-2-CHLORO-1-ISOPROPYL-1-METHYLCYCLOHEXANE;[1S-(1ALPHA,2BETA,4BETA)]-2-CHLORO-4-METHYL-1-(METHYLETHYL)CYCLOHEXANE;[1S-(1alpha,2beta,4beta)]-2-chloro-1-isopropyl-4-methylcyclohexane;(1R)-(-)-MENTHYL CHLORIDE, TERPENE STANDARD | | CAS: | 16052-42-9 | | MF: | C10H19Cl | | MW: | 174.71 | | EINECS: | 240-200-7 | | Product Categories: | Biochemistry;Monocyclic Monoterpenes;Terpenes | | Mol File: | 16052-42-9.mol |  |
| | (-)-MENTHYL CHLORIDE Chemical Properties |
| Melting point | −20-−16.5 °C(lit.) | | Boiling point | 101-101.5 °C21 mm Hg(lit.) | | density | 0.936 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.464 | | Fp | 174 °F | | storage temp. | Store at room temperature | | form | clear liquid | | color | Colorless to Light yellow | | Optical Rotation | [α]20/D 52.4°, neat | | BRN | 1902297 | | InChI | 1S/C10H19Cl/c1-7(2)9-5-4-8(3)6-10(9)11/h7-10H,4-6H2,1-3H3/t8-,9+,10-/m1/s1 | | InChIKey | OMLOJNNKKPNVKN-KXUCPTDWSA-N | | SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1Cl | | LogP | 4.890 (est) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 10 - Combustible liquids |
| | (-)-MENTHYL CHLORIDE Usage And Synthesis |
| Chemical Properties | Liquid. Melting point -20-16.5°C, boiling point 101-101.5 (2.8 kPa), relative density 0.936, refractive index (nD20) 1.4634. Flash point 78°C. | | Uses | 2-Chloro-4-methyl-1-(1-methylethyl)-Cyclohexane is a useful building block for organic synthesis. | | Purification Methods | Dissolve menthyl chloride in pet ether (b 40-60o), wash with H2O, conc H2SO4 until no discoloration of the organic layer occurs (care with conc H2SO4 during shaking in a separating funnel), again with H2O and dry it (MgSO4). Evaporate and distil the residual oil through a Claisen head with a Vigreux neck ( p 11) of ca 40 cm length. [Smith & Wright J Org Chem 17 1116 1952, Barton et al. J Chem Soc 453 1952, Beilstein 5 III 134.] |
| | (-)-MENTHYL CHLORIDE Preparation Products And Raw materials |
|