|
|
| | Diethyl succinosuccinate Basic information |
| Product Name: | Diethyl succinosuccinate | | Synonyms: | 4-cyclohexanedicarboxylicacid,2,5-dioxo-diethylester;2,5-DIOXO-CYCLOHEXANE-1,4-DICARBOXYLIC ACID DIETHYL ESTER;DIETHYL SUCCINYLO SUCCINATE;DIETHYL SUCCINYLSUCCINATE;DIETHYL 1,4-CYCLOHEXANEDIONE-2,5-DICARBOXYLATE;DESS;ETHYL SUCCINYL SUCCINATE;Diethyl 1,4-Cyclohexanedione-2,5-Dicarboxylic Acid | | CAS: | 787-07-5 | | MF: | C12H16O6 | | MW: | 256.25 | | EINECS: | 212-327-8 | | Product Categories: | Aromatic Esters | | Mol File: | 787-07-5.mol |  |
| | Diethyl succinosuccinate Chemical Properties |
| Melting point | 127-129 °C(lit.) | | Boiling point | 375.7±42.0 °C(Predicted) | | density | 1.233±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 9.12±0.40(Predicted) | | form | powder | | Appearance | White to off-white Solid | | Dielectric constant | 2.5(19℃) | | InChI | InChI=1S/C12H16O6/c1-3-17-11(15)7-5-10(14)8(6-9(7)13)12(16)18-4-2/h7-8H,3-6H2,1-2H3 | | InChIKey | KSKWGMNRWCYVAT-UHFFFAOYSA-N | | SMILES | C1(C(OCC)=O)CC(=O)C(C(OCC)=O)CC1=O | | CAS DataBase Reference | 787-07-5(CAS DataBase Reference) | | EPA Substance Registry System | Diethyl 2,5-dioxo-1,4-cyclohexanedicarboxylate (787-07-5) |
| WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | Diethyl succinosuccinate Usage And Synthesis |
| Uses | Diethyl 1,4-cyclohexanedione-2,5-dicarboxylate reacts with benzylamine to yield diethyl 2,5-bis(benzylamino-3,6-dihydroterepthalate), which on polycondensation affords poly(amine esters). | | General Description | Diethyl 1,4-cyclohexanedione-2,5-dicarboxylate reacts with benzylamine to yield diethyl 2,5-bis(benzylamino-3,6-dihydroterepthalate), which on polycondensation affords poly(amine esters). |
| | Diethyl succinosuccinate Preparation Products And Raw materials |
|