Sodium tri-sec-butylborohydride manufacturers
- N-Selectride
-
- $1.10
-
2026-08-25
- CAS:67276-04-4
- Min. Order: 1kg
- Purity: 99%min
- Supply Ability: 100kg
|
| | Sodium tri-sec-butylborohydride Basic information |
| Product Name: | Sodium tri-sec-butylborohydride | | Synonyms: | sodiumtri-sec-butylborohydride,calselect?na,;sodiumtri-sec-butylborohydride,calselect?na,intetrahydrofuran;Sodium tri-sec-butyL;Borate(1-), hydrotris(1-methylpropyl)-, sodium, (T-4)-;sodium tri-sec-butylborohydride solution;sodiuM tri-sec-butylhydroborate;Sodium tri(s-butyl)borohydride;N-Selectride(R) 1.0 M in THF | | CAS: | 67276-04-4 | | MF: | C12H28BNa | | MW: | 206.15 | | EINECS: | 266-630-5 | | Product Categories: | | | Mol File: | 67276-04-4.mol |  |
| | Sodium tri-sec-butylborohydride Chemical Properties |
| density | 0.893 g/mL at 25 °C(lit.) | | Fp | 5 °F | | storage temp. | Flammables + water-Freezer (-20°C)e area | | form | liquid | | InChI | 1S/C12H28B.Na/c1-7-10(4)13(11(5)8-2)12(6)9-3;/h10-13H,7-9H2,1-6H3;/q-1;+1 | | InChIKey | JUFGMKFPFVIKOY-UHFFFAOYSA-N | | SMILES | [Na+].CCC(C)[BH-](C(C)CC)C(C)CC |
| Hazard Codes | F,C | | Risk Statements | 11-14/15-19-22-34-37-40 | | Safety Statements | 16-26-27-36/37/39-45-43 | | RIDADR | UN 3399 4.3/PG 1 | | WGK Germany | 1 | | HS Code | 29319090 | | Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water | | Hazard Classifications | Acute Tox. 4 Oral
Carc. 2
Flam. Liq. 2
Skin Corr. 1B
STOT SE 3
Water-react 1 |
| | Sodium tri-sec-butylborohydride Usage And Synthesis |
| Chemical Properties | clear colorless to yellow solution | | Uses | Reducing agent Reactant for: Conjugate hydride reduction-initiated tandem cyclization reactions Sereoselective nucleophilic addition reactions. | | Uses |
Reactant for:
- Conjugate hydride reduction-initiated tandem cyclization reactions
- Sereoselective nucleophilic addition reactions
| | reaction suitability | reagent type: reductant |
| | Sodium tri-sec-butylborohydride Preparation Products And Raw materials |
|