| Company Name: |
Henan Kehong Biological Technology Co. LTD Gold
|
| Tel: |
0371-86658258 ；0371-55969461 |
| Email: |
info@kehobio.com |
| Products Intro: |
Product Name:4-AMINO-2-BENZOTHIAZOL-2-YL-PHENOL
CAS:30616-38-7
Purity:98% Package:50kg
|
| Company Name: |
Jinan Yaode Biotechnology Co., Ltd Gold
|
| Tel: |
17805033575 |
| Email: |
baiyu1.618@163.com |
| Products Intro: |
CAS:30616-38-7
Purity:97%HPLC Package:5KG;1KG;500G;250G;100G;25G;10G
|
4-AMINO-2-BENZOTHIAZOL-2-YL-PHENOL manufacturers
|
| | 4-AMINO-2-BENZOTHIAZOL-2-YL-PHENOL Basic information |
| Product Name: | 4-AMINO-2-BENZOTHIAZOL-2-YL-PHENOL | | Synonyms: | 2-(5-Amino-2-hydroxyphenyl)benzothiazole >=97% (HPLC);ART-CHEM-BB B025297;ASISCHEM T30912;4-AMINO-2-(1,3-BENZOTHIAZOL-2-YL)PHENOL;4-AMINO-2-BENZOTHIAZOL-2-YL-PHENOL;AKOS BB-8262;TIMTEC-BB SBB007319;2-(5-Amino-2-hydroxyphenyl)benzothiazole | | CAS: | 30616-38-7 | | MF: | C13H10N2OS | | MW: | 242.3 | | EINECS: | | | Product Categories: | | | Mol File: | 30616-38-7.mol |  |
| | 4-AMINO-2-BENZOTHIAZOL-2-YL-PHENOL Chemical Properties |
| Melting point | 190-190.5 °C | | Boiling point | 490.6±55.0 °C(Predicted) | | density | 1.406±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder | | pka | 8.33±0.43(Predicted) | | BRN | 212070 | | InChI | InChI=1S/C13H10N2OS/c14-8-5-6-11(16)9(7-8)13-15-10-3-1-2-4-12(10)17-13/h1-7,16H,14H2 | | InChIKey | UBRCBHVOYDSGKZ-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(N)C=C1C1=NC2=CC=CC=C2S1 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2934208090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-AMINO-2-BENZOTHIAZOL-2-YL-PHENOL Usage And Synthesis |
| Uses | 2-(5-Amino-2-hydroxyphenyl)benzothiazole is a fluorescent dye that may be used in the synthesis of a photoactive hybrid material by dispersion in a silica matrix with potential application in optical sensors. It may also be used to synthesize N-[3-(benzothiazol-2-yl)-4-hydroxyphenyl]-octanamide that shows the existence of an excited-state intramolecular proton transfer (ESIPT) process. |
| | 4-AMINO-2-BENZOTHIAZOL-2-YL-PHENOL Preparation Products And Raw materials |
|