Bis[4-fluorophenyl] sulfoxide manufacturers
|
| | Bis[4-fluorophenyl] sulfoxide Basic information |
| Product Name: | Bis[4-fluorophenyl] sulfoxide | | Synonyms: | 1,1'-Sulfinylbis[4-fluorobenzene];Bis(4-fluorophenyl) sulfoxide;Bis[4-fluorophenyl] sulfoxide;4,4'-Difluorodiphenyl sulfoxide;1-fluoro-4-(4-fluorophenyl)sulfinylbenzene;Bis(p-fluorophenyl) sulfoxide;Benzene, 1,1'-sulfinylbis[4-fluoro-;DK772 | | CAS: | 395-25-5 | | MF: | C12H8F2OS | | MW: | 238.25 | | EINECS: | | | Product Categories: | | | Mol File: | 395-25-5.mol | ![Bis[4-fluorophenyl] sulfoxide Structure](CAS/GIF/395-25-5.gif) |
| | Bis[4-fluorophenyl] sulfoxide Chemical Properties |
| Melting point | 46.6-47.0℃ (hexane ) | | InChI | InChI=1S/C12H8F2OS/c13-9-1-5-11(6-2-9)16(15)12-7-3-10(14)4-8-12/h1-8H | | InChIKey | GVYKABJIEOOUOX-UHFFFAOYSA-N | | SMILES | S(C1=CC=C(F)C=C1)(C1=CC=C(F)C=C1)=O |
| | Bis[4-fluorophenyl] sulfoxide Usage And Synthesis |
| | Bis[4-fluorophenyl] sulfoxide Preparation Products And Raw materials |
|