|
|
| | Butyl 2,4-dichlorophenoxyacetate Basic information |
| | Butyl 2,4-dichlorophenoxyacetate Chemical Properties |
| Melting point | 9°C | | Boiling point | 146-147°C | | density | 1.2639 (rough estimate) | | refractive index | 1.5209 (estimate) | | storage temp. | 0-6°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | color | Colourless | | Water Solubility | <0.1 g/100 mL at 21 ºC | | BRN | 2056085 | | Stability: | Stable. Incompatible with strong oxidizing agents. | | Major Application | agriculture environmental | | InChI | 1S/C12H14Cl2O3/c1-2-3-6-16-12(15)8-17-11-5-4-9(13)7-10(11)14/h4-5,7H,2-3,6,8H2,1H3 | | InChIKey | UQMRAFJOBWOFNS-UHFFFAOYSA-N | | SMILES | CCCCOC(=O)COc1ccc(Cl)cc1Cl | | CAS DataBase Reference | 94-80-4(CAS DataBase Reference) | | NIST Chemistry Reference | Butyl (2,4-dichlorophenoxy)acetate(94-80-4) | | EPA Substance Registry System | 2,4-D butyl ester (94-80-4) |
| Hazard Codes | Xn;N,N,Xn | | Risk Statements | 22-43-50/53 | | Safety Statements | 26-29-36/37-46-60-61 | | RIDADR | UN 3082 | | WGK Germany | 3 | | RTECS | AG8050000 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 | | Hazardous Substances Data | 94-80-4(Hazardous Substances Data) | | Toxicity | LD50 oral in rat: 600mg/kg |
| | Butyl 2,4-dichlorophenoxyacetate Usage And Synthesis |
| Chemical Properties | colourless liquid | | Uses | 2,4-D-1-butyl ester may be used as a reference standard for the determination of 2,4-D-1-butyl ester in soil samples by capillary high performance liquid chromatography with ultraviolet detection. | | General Description | Clear colorless to light brown liquid. | | Air & Water Reactions | Insoluble in water. | | Reactivity Profile | Butyl 2,4-dichlorophenoxyacetate is an ester. Esters react with acids to liberate heat along with alcohols and acids. Strong oxidizing acids may cause a vigorous reaction that is sufficiently exothermic to ignite the reaction products. Heat is also generated by the interaction of esters with caustic solutions. Flammable hydrogen is generated by mixing esters with alkali metals and hydrides. | | Fire Hazard | Flash point data for Butyl 2,4-dichlorophenoxyacetate are not available. Butyl 2,4-dichlorophenoxyacetate is probably combustible. |
| | Butyl 2,4-dichlorophenoxyacetate Preparation Products And Raw materials |
|