| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1-(Trifluoromethyl)cyclopentane-1-carboxylic acid Basic information |
| | 1-(Trifluoromethyl)cyclopentane-1-carboxylic acid Chemical Properties |
| Melting point | 37-38°C | | Boiling point | 205.5±35.0 °C(Predicted) | | density | 1.375±0.06 g/cm3(Predicted) | | Fp | >110℃ | | storage temp. | 2-8°C | | form | solid | | pka | 2.17±0.20(Predicted) | | Appearance | Colorless to off-white <35°C Solid, >39°C Liquid | | Water Solubility | Insoluble in water. | | InChI | InChI=1S/C7H9F3O2/c8-7(9,10)6(5(11)12)3-1-2-4-6/h1-4H2,(H,11,12) | | InChIKey | DGQRYPPBAJNZFZ-UHFFFAOYSA-N | | SMILES | C1(C(F)(F)F)(C(O)=O)CCCC1 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2916200090 |
| | 1-(Trifluoromethyl)cyclopentane-1-carboxylic acid Usage And Synthesis |
| Uses | 1-(Trifluoromethyl)cyclopentanecarboxylic acid is used as pharmaceutical intermediate. | | Definition | ChEBI: 1-(Trifluoromethyl)cyclopentane-1-carboxylic acid is a carboxylic acid. |
| | 1-(Trifluoromethyl)cyclopentane-1-carboxylic acid Preparation Products And Raw materials |
|