|
|
| | 5-(Diphenylphosphinyl)pentanoic Acid Basic information |
| | 5-(Diphenylphosphinyl)pentanoic Acid Chemical Properties |
| Melting point | 139-131°C | | Boiling point | 462.7±28.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.70±0.10(Predicted) | | color | White to Off-White | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C17H19O3P.Na/c18-17(19)13-7-8-14-21(20,15-9-3-1-4-10-15)16-11-5-2-6-12-16;/h1-6,9-12H,7-8,13-14H2,(H,18,19);/q;+1/p-1 | | InChIKey | FPELTQBQNWIJFD-UHFFFAOYSA-M | | SMILES | [Na+].[P](=O)(CCCCC(=O)[O-])(c2ccccc2)c1ccccc1 |
| Storage Class | 11 - Combustible Solids |
| | 5-(Diphenylphosphinyl)pentanoic Acid Usage And Synthesis |
| Description | The Wittig reaction is a frequently used method for olefin synthesis involving a phosphorane ylide and an aldehyde or ketone. DPP is a common by-product of this reaction. DPP can be used as a standard in analyzing products of synthetic routes that utilize the Wittig reaction. | | Uses | 5-(Diphenylphosphinyl)pentanoic Acid, can be used for the preparation of praseodymium coordination polymers with diphenylphosphorylvalerate ligand. It is also a by product in the preparation of prostaglandin analogs. | | Definition | ChEBI: Diphenylphosphine Acid is a phosphine. |
| | 5-(Diphenylphosphinyl)pentanoic Acid Preparation Products And Raw materials |
|