- 3-OXETANAMINE, 3-METHYL-
-
- $15.00 / 1KG
-
2021-07-02
- CAS:874473-14-0
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 3-OXETANAMINE, 3-METHYL- Basic information |
| Product Name: | 3-OXETANAMINE, 3-METHYL- | | Synonyms: | 3-OXETANAMINE, 3-METHYL-;3-methyloxetan-3-amine;3-Methyl-3-oxetanamine;3-Amino-3-methyloxetane;3-OXETAMINE, 3-METHYL-;3-Methyl-3-oxetanaMine hcl;3-Amino-3-methyloxetane >;3-Amino-3-methyL | | CAS: | 874473-14-0 | | MF: | C4H9NO | | MW: | 87.12 | | EINECS: | | | Product Categories: | | | Mol File: | 874473-14-0.mol |  |
| | 3-OXETANAMINE, 3-METHYL- Chemical Properties |
| Boiling point | 102℃ | | density | 1.937 g/mL at 25 °C | | refractive index | n20/D1.444 | | Fp | 96 °C | | storage temp. | -20°C | | form | Crystalline Solid | | pka | 8.68±0.20(Predicted) | | color | Colorless to Almost colorless | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C4H9NO/c1-4(5)2-6-3-4/h2-3,5H2,1H3 | | InChIKey | NQVWMPOQWBDSAI-UHFFFAOYSA-N | | SMILES | O1CC(C)(N)C1 |
| Hazard Codes | Xn | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2922390090 |
| | 3-OXETANAMINE, 3-METHYL- Usage And Synthesis |
| Chemical Properties | Colorless to pale yellow liquid | | Uses | It is used as an OLED intermediate. |
| | 3-OXETANAMINE, 3-METHYL- Preparation Products And Raw materials |
|