|
|
| | TETRAPHENYLGERMANE Basic information |
| | TETRAPHENYLGERMANE Chemical Properties |
| Melting point | 230-235 °C (lit.) | | Boiling point | >400°C | | refractive index | 1.5800 | | storage temp. | RT, protect from light, stored under nitrogen | | form | solid | | color | White to Almost white | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | InChI=1S/C24H20Ge/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H | | InChIKey | ILEXMONMGUVLRM-UHFFFAOYSA-N | | SMILES | [Ge](C1=CC=CC=C1)(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 | | CAS DataBase Reference | 1048-05-1(CAS DataBase Reference) | | EPA Substance Registry System | Germane, tetraphenyl- (1048-05-1) |
| | TETRAPHENYLGERMANE Usage And Synthesis |
| Chemical Properties | White crystalline powder | | reaction suitability | core: germanium
reagent type: catalyst |
| | TETRAPHENYLGERMANE Preparation Products And Raw materials |
|