| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | 1-Butyl-1-methylpiperidinium bis(trifluoromethylsulfonyl)imide Basic information | | Uses |
| Product Name: | 1-Butyl-1-methylpiperidinium bis(trifluoromethylsulfonyl)imide | | Synonyms: | PP14-TFSI;[C4MPd]NTf2;N-propyl-methyl piperidinium bis(trifluoromethylsulfonyl)imide in stock Factory;N-butyl,methyl-piperidinium bis((trifluoromethyl)sulfonyl)imide;N-propyl,methyl-piperidinium bis((trifluoromethyl)sulfonyl)imide;N-ethyl,methyl-piperidinium bis((trifluoromethyl)sulfonyl)imide;P1,2NTF2;1-Butyl-1-methylpiperidinium bis(trifluoromethylsulfonyl)imide 97% | | CAS: | 623580-02-9 | | MF: | C10H22N.C2F6NO4S2 | | MW: | 436.436 | | EINECS: | 200-144-5 | | Product Categories: | | | Mol File: | 623580-02-9.mol |  |
| | 1-Butyl-1-methylpiperidinium bis(trifluoromethylsulfonyl)imide Chemical Properties |
| Melting point | -25 °C | | density | 1.39 | | refractive index | 1.4290-1.4330 | | storage temp. | 2-8°C, sealed storage, away from moisture | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | BRN | 10137193 | | InChI | 1S/C10H22N.C2F6NO4S2/c1-3-4-8-11(2)9-6-5-7-10-11;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-10H2,1-2H3;/q+1;-1 | | InChIKey | ZDMWZUAOSLBMEY-UHFFFAOYSA-N | | SMILES | O=S([N-]S(=O)(C(F)(F)F)=O)(C(F)(F)F)=O.C[N+]1(CCCC)CCCCC1 | | ECW | 3.7 V |
| Hazard Codes | T,N | | Risk Statements | 24/25-34-51/53 | | Safety Statements | 26-36/37/39-45-61 | | RIDADR | UN 2922 6.1(8) / PGIII | | WGK Germany | 3 | | HS Code | 29350090 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral Eye Dam. 1 Skin Corr. 1B |
| | 1-Butyl-1-methylpiperidinium bis(trifluoromethylsulfonyl)imide Usage And Synthesis |
| Uses | bis(trifluoromethylsulfonyl)azanide;1-butyl-1-methylpiperidin-1-ium is a useful research chemical. | | Conductivity | 0.84 mS/cm (25 °C) | | Uses | 1-Butyl-1-methylpiperidinium bis(trifluoromethylsulfonyl)imide is an ionic liquid that can be used:
- As an electrolyte in ionic liquid dual ion battery and dual-graphite battery.
- As a model ionic liquid in the study of ionic effect on the desulfurization of fuels.
- In the study of the activity coefficient of different solutes at infinite dilution.
| | General Description | 1-Butyl-1-methylpiperidinium bis(trifluoromethylsulfonyl)imide is a class of electrolytic materials that can be used in the fabrication of lithium-ion batteries. Lithium-ion batteries consist of anode, cathode, and electrolyte with a charge-discharge cycle. These materials enable the formation of greener and sustainable batteries for electrical energy storage. |
| | 1-Butyl-1-methylpiperidinium bis(trifluoromethylsulfonyl)imide Preparation Products And Raw materials |
|