| Company Name: |
Novel Chemical |
| Tel: |
+86-21-64855560, 4008207808 |
| Email: |
sales@novelglobal.com |
|
| | n-Octyldiisopropylchlorosilane Basic information |
| Product Name: | n-Octyldiisopropylchlorosilane | | Synonyms: | CHLORODIISOPROPYLOCTYLSILANE;OCTYLDIISOPROPYLCHLOROSILANE;diisopropyloctylchlorosilane;Diisopropyloctylchlorosilane, Octyldiisopropylchlorosilane;chloro-octyl-di(propan-2-yl)silane;Silane, chlorobis(1-methylethyl)octyl-;N-Ctyldiisopropylchlorosilane;DKFELEX0296 | | CAS: | 117559-37-2 | | MF: | C14H31ClSi | | MW: | 262.93 | | EINECS: | | | Product Categories: | | | Mol File: | 117559-37-2.mol |  |
| | n-Octyldiisopropylchlorosilane Chemical Properties |
| Melting point | <0°C | | Boiling point | 95-99°C 0,5mm | | density | 0.875 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.455(lit.) | | Fp | >230 °F | | form | liquid | | Specific Gravity | 0.875 | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | 1S/C14H31ClSi/c1-6-7-8-9-10-11-12-16(15,13(2)3)14(4)5/h13-14H,6-12H2,1-5H3 | | InChIKey | SALITQCKMBTLPL-UHFFFAOYSA-N | | SMILES | CCCCCCCC[Si](Cl)(C(C)C)C(C)C |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2987 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | TSCA | No | | HazardClass | 8 | | PackingGroup | II | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | n-Octyldiisopropylchlorosilane Usage And Synthesis |
| Synthesis | Improvement of the synthesis method of diisopropylchlorosilane by replacing ether with tetrahydrofuran allows the reaction to be scaled up to a production scale of kilograms or more. The format reagent of isopropylmagnesium chloride is obtained by reacting 2-chloropropane and magnesium chips in tetrahydrofuran; then the format reagent of isopropylmagnesium chloride is reacted with trichlorosilane, and then the product is obtained by distillation.
|
| | n-Octyldiisopropylchlorosilane Preparation Products And Raw materials |
|