|
|
| | Calycopterin Basic information |
| Product Name: | Calycopterin | | Synonyms: | Calycopterin;4H-1-Benzopyran-4-one, 5-hydroxy-2-(4-hydroxyphenyl)-3,6,7,8-tetramethoxy-;Calycopterin-RM | | CAS: | 481-52-7 | | MF: | C19H18O8 | | MW: | 374.34 | | EINECS: | | | Product Categories: | | | Mol File: | 481-52-7.mol |  |
| | Calycopterin Chemical Properties |
| Melting point | 226-228 °C(Solv: ethyl acetate (141-78-6)) | | Boiling point | 639.5±55.0 °C(Predicted) | | density | 1.44±0.1 g/cm3(Predicted) | | pka | 6.66±0.40(Predicted) | | Major Application | food and beverages | | InChIKey | PIUSRRUXGNYCSS-UHFFFAOYSA-N | | SMILES | [o]1c2c([c](c(c1c3ccc(cc3)O)OC)=O)c(c(c(c2OC)OC)OC)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Calycopterin Usage And Synthesis |
| Uses | food and beverages | | Definition | ChEBI: 5-hydroxy-2-(4-hydroxyphenyl)-3,6,7,8-tetramethoxy-4H-chromen-4-one is an ether and a member of flavonoids. |
| | Calycopterin Preparation Products And Raw materials |
|