|
|
| | O-Desethyl Candesartan Cilexetil Basic information |
| Product Name: | O-Desethyl Candesartan Cilexetil | | Synonyms: | 1-(Cyclohexyloxycarbonyloxy)ethyl 1-((2'-(1H-tetrazol-5-yl)biphenyl-4-yl) methyl)-2-hydroxy-1H-benzo[d]imidazole-7-carboxylate;Candesartan Impurity 1;Candesartan Cilexetil Impurity 2(EP Impurity B);O-Desethyl Candesartan Cilexetil
;2,3-Dihydro-2-oxo-3-[[2'-(2H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]Methyl]-1H-benziMidazole-4-carboxylic Acid 1-[[(Cyclohexyloxy)carbonyl]oxy]ethyl Ester;Candesartan Cilexetil ImpuritⅠ: O-Desethyl Candesartan Cilexetil( 2,3-Dihydro-2-oxo-3-[[2'-(2H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl]-1H-benzimidazole-4-carboxylic Acid 1-[[(Cyclohexyloxy)carbonyl]oxy]ethyl Ester);Candesartan EP Imp B;1-cyclohexyloxycarbonyloxyethyl 2-oxo-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1H-benzimidazole-4-carboxylate | | CAS: | 869631-11-8 | | MF: | C31H30N6O6 | | MW: | 582.61 | | EINECS: | | | Product Categories: | Aromatics;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 869631-11-8.mol |  |
| | O-Desethyl Candesartan Cilexetil Chemical Properties |
| Melting point | 237-239C (dec.) | | density | 1.43±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 4.16±0.10(Predicted) | | form | Solid | | color | White | | Major Application | pharmaceutical | | InChIKey | UEJMFQHOVKQHHB-UHFFFAOYSA-N | | SMILES | [nH]1nnc(n1)c2c(cccc2)c3ccc(cc3)C[n]4c5c(nc4O)cccc5C(=O)OC(OC(=O)OC6CCCCC6)C |
| WGK Germany | WGK 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | O-Desethyl Candesartan Cilexetil Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | O-Desethyl Candesartan Cilexetil (Candesartan Cilexetil EP Impurity B) is used for the preparation of Candesartan Cilexetil (CAT# C175580), which is an antihypertensive. It may be obtained as a degradation product of Candesartan Cilexetil in liquid chromatography studies. | | Uses | O-Desethyl Candesartan Cilexetil can be used for the preparation of Candesartan cilexetil. |
| | O-Desethyl Candesartan Cilexetil Preparation Products And Raw materials |
|