|
|
| | S(+)-deprenyl hydrochloride Basic information |
| Product Name: | S(+)-deprenyl hydrochloride | | Synonyms: | (+)-deprenilhydrochloride;(+)-e-250;(+)-n,alpha-dimethyl-n-2-propynylphenethylaminehydrochloride;(+)-phenylisopropylmethylpropynylaminehydrochloride;n,alpha-dimethyl-n-2-propynyl-,hydrochloride,(s)-benzeneethanamin;n,alpha-dimethyl-n-2-propynyl-,hydrochloride,d-(+)-phenethylamin;Benzeneethanamine, N,a-dimethyl-N-2-propynyl-, hydrochloride, (S)- (9CI);Phenethylamine, N,a-dimethyl-N-2-propynyl-, hydrochloride, D-(+)- (8CI) | | CAS: | 4528-52-3 | | MF: | C13H17N.ClH | | MW: | 223.74 | | EINECS: | | | Product Categories: | | | Mol File: | 4528-52-3.mol |  |
| | S(+)-deprenyl hydrochloride Chemical Properties |
| Melting point | 134 - 138°C | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | H2O: soluble | | form | solid | | color | white | | Optical Rotation | [α]24/D +11.84°, c =0.1 in H2O(lit.) | | Water Solubility | H2O: soluble | | SMILES | Cl.C[C@@H](Cc1ccccc1)N(C)CC#C |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | S(+)-deprenyl hydrochloride Usage And Synthesis |
| Uses | S-(+)-Deprenyl is the S-enantiomer of Deprenyl. R-(-)-Deprenyl (D288641) is in pharmaceutical formulations. | | Uses | less active enantiomer, water soluble | | Biological Activity | Less active enantiomer of deprenyl. |
| | S(+)-deprenyl hydrochloride Preparation Products And Raw materials |
|