|
|
| | 6,6'-Oxybis- Basic information |
| | 6,6'-Oxybis- Chemical Properties |
| Melting point | >300C | | storage temp. | Refrigerator | | solubility | Methanol (Very Slightly), Water (Very Slightly, Heated) | | form | Solid | | color | White to Pale Grey | | InChI | InChI=1S/C20H14O7S2.Na.H/c21-28(22,23)19-7-3-13-9-17(5-1-15(13)11-19)27-18-6-2-16-12-20(29(24,25)26)8-4-14(16)10-18;;/h1-12H,(H,21,22,23)(H,24,25,26);; | | InChIKey | ZHTHVKNANRUFCR-UHFFFAOYSA-N | | SMILES | O(C1C=CC2=CC(S(O)(=O)=O)=CC=C2C=1)C1C=CC2=CC(S(O)(=O)=O)=CC=C2C=1.[NaH] |
| | 6,6'-Oxybis- Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | An impurity contained in the commercial food Yellow No.5 (Sunset Yellow FCF) which has a potent mutagenicity effect. |
| | 6,6'-Oxybis- Preparation Products And Raw materials |
|