|
|
| | 2-Bromo-3-fluoro-4-pyridinecarboxylic acid Basic information |
| | 2-Bromo-3-fluoro-4-pyridinecarboxylic acid Chemical Properties |
| Boiling point | 408.9±45.0 °C(Predicted) | | density | 1.903±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Solid | | pka | 2.05±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H3BrFNO2/c7-5-4(8)3(6(10)11)1-2-9-5/h1-2H,(H,10,11) | | InChIKey | DHFIVEUMGCJILQ-UHFFFAOYSA-N | | SMILES | C1(Br)=NC=CC(C(O)=O)=C1F |
| | 2-Bromo-3-fluoro-4-pyridinecarboxylic acid Usage And Synthesis |
| | 2-Bromo-3-fluoro-4-pyridinecarboxylic acid Preparation Products And Raw materials |
|