|
|
| | ethyl 4-aminothiazole-5-carboxylate Basic information |
| Product Name: | ethyl 4-aminothiazole-5-carboxylate | | Synonyms: | ethyl 4-aminothiazole-5-carboxylate;5-Thiazolecarboxylic acid, 4-aMino-, ethyl ester;ethyl 4-aMinothiazole-5-carboxylateethyl ester;Ethyl-4-amino-5-thiazolecarboxylate;CAS:152300-59-9 | | CAS: | 152300-59-9 | | MF: | C6H8N2O2S | | MW: | 172.2 | | EINECS: | | | Product Categories: | | | Mol File: | 152300-59-9.mol |  |
| | ethyl 4-aminothiazole-5-carboxylate Chemical Properties |
| Boiling point | 300.7±22.0 °C(Predicted) | | density | 1.336±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 1.39±0.10(Predicted) | | form | solid | | color | Pale yellow | | InChI | InChI=1S/C6H8N2O2S/c1-2-10-6(9)4-5(7)8-3-11-4/h3H,2,7H2,1H3 | | InChIKey | FJFZZDZSPYBKBD-UHFFFAOYSA-N | | SMILES | S1C(C(OCC)=O)=C(N)N=C1 |
| | ethyl 4-aminothiazole-5-carboxylate Usage And Synthesis |
| | ethyl 4-aminothiazole-5-carboxylate Preparation Products And Raw materials |
|