| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
1,2,3,4-CYCLOBUTANETETRACARBOXYLIC ACID manufacturers
|
| | 1,2,3,4-CYCLOBUTANETETRACARBOXYLIC ACID Basic information |
| Product Name: | 1,2,3,4-CYCLOBUTANETETRACARBOXYLIC ACID | | Synonyms: | 1,2,3,4-CYCLOBUTANETETRACARBOXYLIC ACID;1,2,3,4-Cyclobutanetetracarboxylic Acid >1,2,3,4-CyclobutanetetracarboxylicAci;1,2,3,4-cyclobutanetracarboxylic acid | | CAS: | 53159-92-5 | | MF: | C8H8O8 | | MW: | 232.14 | | EINECS: | | | Product Categories: | C8;Carbonyl Compounds;Carboxylic Acids | | Mol File: | 53159-92-5.mol |  |
| | 1,2,3,4-CYCLOBUTANETETRACARBOXYLIC ACID Chemical Properties |
| Melting point | 242 °C (dec.) (lit.) | | Boiling point | 439.2±45.0 °C(Predicted) | | density | 1.934±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | methanol: soluble10mg/mL, clear, colorless to light yellow | | pka | 3.03±0.70(Predicted) | | form | Solid | | color | Off-White | | InChI | 1S/C8H8O8/c9-5(10)1-2(6(11)12)4(8(15)16)3(1)7(13)14/h1-4H,(H,9,10)(H,11,12)(H,13,14)(H,15,16) | | InChIKey | CURBACXRQKTCKZ-UHFFFAOYSA-N | | SMILES | OC(=O)C1C(C(C1C(O)=O)C(O)=O)C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | RIDADR | 1759 | | WGK Germany | 3 | | HS Code | 2917.20.0000 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,2,3,4-CYCLOBUTANETETRACARBOXYLIC ACID Usage And Synthesis |
| Uses | 1,2,3,4-Cyclobutanetetracarboxylic acid was employed as capping ligand in the preparation of gold colloids. | | General Description | 1,2,3,4-Cyclobutanetetracarboxylic acid forms cobalt(II) complex under hydrothermal conditions and its crystal structure was studied by synchrotron radiation and neutron powder diffraction. |
| | 1,2,3,4-CYCLOBUTANETETRACARBOXYLIC ACID Preparation Products And Raw materials |
|