| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(S)-(?)-2-AMino-3-Methyl-1,1-diphenylbutane CAS:233772-37-7 Purity:98% Package:500MG
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:(S)-(-)-2-Amino-3-methyl-1,1-diphenylbutane CAS:233772-37-7 Purity:98% Package:500MG Remarks:551147-500MG
|
|
| | (S)-(-)-2-AMINO-3-METHYL-1,1-DIPHENYLBUTANE Basic information |
| | (S)-(-)-2-AMINO-3-METHYL-1,1-DIPHENYLBUTANE Chemical Properties |
| Melting point | 73-76 °C (lit.) | | Optical Rotation | [α]20/D 6.5°, c = 1 in chloroform | | InChI | 1S/C17H21N/c1-13(2)17(18)16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13,16-17H,18H2,1-2H3/t17-/m0/s1 | | InChIKey | KJRIVAFIKUXDBL-KRWDZBQOSA-N | | SMILES | CC(C)[C@H](N)C(c1ccccc1)c2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2921490090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-(-)-2-AMINO-3-METHYL-1,1-DIPHENYLBUTANE Usage And Synthesis |
| Uses | (S)-()-2-Amino-3-methyl-1,1-diphenylbutane can be used as a chiral test compound in the enantio-separation of primary amines by supercritical fluid chromatography (SFC). |
| | (S)-(-)-2-AMINO-3-METHYL-1,1-DIPHENYLBUTANE Preparation Products And Raw materials |
|