- Mal-amido-PEG8-NHS
-
-
2025-06-07
- CAS:756525-93-6
- Min. Order: 1g
- Purity: >98.00%
- Supply Ability: 1g
|
| | alpha-MaleiMidopropionyl-oMega-succiniMidyl-8(ethylene glycol) Basic information |
| Product Name: | alpha-MaleiMidopropionyl-oMega-succiniMidyl-8(ethylene glycol) | | Synonyms: | alpha-MaleiMidopropionyl-oMega-succiniMidyl-8(ethylene glycol);α-MaleiMidopropionyl-ω-succiniMidyl-8(ethylene glycol);N-[27-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-27-oxo-3,6,9,12,15,18,21,24-octaoxaheptacos-1-yl]-2,5-dihydro-2,5-dioxo-1H-pyrrole-1-propanamide;31-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-29-oxo-4,7,10,13,16,19,22,25-octaoxa-28-azahentriacontanoic acid 2,5-dioxo-1-pyrrolidinyl ester;Mal-NH-PEG8-NHS ester;Maleimide PEG8 succinimidyl ester;Maleimide-PEG8-NHS;Maleimide-PEG8-NHS ester | | CAS: | 756525-93-6 | | MF: | C30H47N3O15 | | MW: | 689.71 | | EINECS: | | | Product Categories: | peg | | Mol File: | 756525-93-6.mol |  |
| | alpha-MaleiMidopropionyl-oMega-succiniMidyl-8(ethylene glycol) Chemical Properties |
| density | 1.30±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO : ≥ 100 mg/mL (144.99 mM) | | pka | 15.01±0.46(Predicted) | | form | powder | | color | Light yellowish | | InChIKey | MTPWCXBUZLEBDD-UHFFFAOYSA-N | | SMILES | C(ON1C(=O)CCC1=O)(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCN1C(=O)C=CC1=O |
| WGK Germany | 3 | | HS Code | 2928009090 | | Storage Class | 10 - Combustible liquids |
| | alpha-MaleiMidopropionyl-oMega-succiniMidyl-8(ethylene glycol) Usage And Synthesis |
| Description | Mal-amido-PEG8-NHS is a PEG linker containing a maleimide group and an NHS ester. The hydrophilic PEG spacer increases solubility in aqueous media. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. The maleimide group will react with a thiol group to form a covalent bond, enabling the connection of biomolecule with a thiol. | | Uses | Heterobifunctional crosslinker with an ethylene oxide spacer for linking amine- to sulfhydryl-containing compounds or biomolecules. Maleimide functional group will react with sulfhydryls and the succinimidyl ester group will react with amines. Spacer length is 39.2 angstroms. | | reaction suitability | reaction type: Pegylations
reagent type: cross-linking reagent | | IC 50 | PEGs; Alkyl/ether |
| | alpha-MaleiMidopropionyl-oMega-succiniMidyl-8(ethylene glycol) Preparation Products And Raw materials |
|