|
|
| | N-Desmethyl-cis-tramadol HCl Basic information |
| Product Name: | N-Desmethyl-cis-tramadol HCl | | Synonyms: | N-Desmethyl-cis-tramadol HCl;N-DeMethyltraMadol Hydrochloride;N-Desmethyl-cis-tramadol hydrochloride solution;N-Desmethyl Tramadol HCl Labeled d6;(1R,2R)-1-(3-Methoxyphenyl)-2-[(methylamino)methyl]cyclohexanol h ydrochloride (1:1);N-Desmethyl Tramadol HCl ( Enantiomer );*Phenobarbital Impurity 17-d6;N-Desmethyltramadol Hydrochloride 1.0 mg/ml in Methanol (as free base) | | CAS: | 1018989-94-0 | | MF: | C15H24ClNO2 | | MW: | 285.81 | | EINECS: | | | Product Categories: | | | Mol File: | 1018989-94-0.mol |  |
| | N-Desmethyl-cis-tramadol HCl Chemical Properties |
| Melting point | 165-168 °C(Solv: acetone (67-64-1); hexane (110-54-3)) | | Fp | 9℃ | | storage temp. | -20°C | | form | liquid | | Major Application | forensics and toxicology | | InChI | 1S/C15H23NO2.ClH/c1-16-11-13-6-3-4-9-15(13,17)12-7-5-8-14(10-12)18-2;/h5,7-8,10,13,16-17H,3-4,6,9,11H2,1-2H3;1H/t13-,15+;/m1./s1 | | InChIKey | NOZLWRHUQJHIRG-PBCQUBLHSA-N | | SMILES | CNC[C@H]1CCCC[C@]1(O)C2=CC(OC)=CC=C2.[H]Cl |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | N-Desmethyl-cis-tramadol HCl Usage And Synthesis |
| Uses | N-Demethyltramadol Hydrochloride is a metabolite of Tramadol (T712510), an analgesic. Used in the treatment of urinary incontinence. | | Definition | ChEBI: N-Desmethyltramadol is a member of methoxybenzenes. |
| | N-Desmethyl-cis-tramadol HCl Preparation Products And Raw materials |
|