| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Pinacyanol chloride Basic information |
| Product Name: | Pinacyanol chloride | | Synonyms: | 1,1μ-Diethyl-2,2μ-carbocyanine chloride, 2,2μ-Trimethinequinocyanine chloride, Quinaldine blue;NSC-56808;Pinacyanol chloride,97%;1,1'-Diethyl-2,2'-carbocyanine Chloride
Quinaldine Blue;1-ethyl-2-((1E,3E)-3-(1-ethylquinolin-2(1H)-ylidene)prop-1-en-1-yl)quinolin-1-iuM chloride;Pinacyanol chloride,1,1′-Diethyl-2,2′-carbocyanine chloride, 2,2′-Trimethinequinocyanine chloride, Quinaldine blue;1,1′-Diethyl-2,2′-triMethinequinocy;1-ethyl-2-[3-(1-ethyl-2(1h)-quinolinylidene)-1-propenyl]-quinoliniuchlorid | | CAS: | 2768-90-3 | | MF: | C25H25ClN2 | | MW: | 388.93 | | EINECS: | 220-457-1 | | Product Categories: | Quinolinecarboxylic Acids, etc.;Quinolines | | Mol File: | 2768-90-3.mol |  |
| | Pinacyanol chloride Chemical Properties |
| Melting point | 270 °C (dec.)(lit.) | | Boiling point | 543.58°C (rough estimate) | | density | 1.0453 (rough estimate) | | refractive index | 1.5940 (estimate) | | storage temp. | 2-8°C | | form | powder to crystal | | color | Green to Dark green | | λmax | 560 nm (2nd)
604 nm | | ε(extinction coefficient) | ≥150000 at 603-609nm in ethanol at 0.001g/L
≥65000 at 559-565nm in ethanol at 0.001g/L | | Merck | 14,8048 | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C25H25N2.ClH/c1-3-26-22(18-16-20-10-5-7-14-24(20)26)12-9-13-23-19-17-21-11-6-8-15-25(21)27(23)4-2;/h5-19H,3-4H2,1-2H3;1H/q+1;/p-1 | | InChIKey | FVMNARAKYNRZID-UHFFFAOYSA-M | | SMILES | [Cl-].CCN1C(=C\C=C\c2ccc3ccccc3[n+]2CC)\C=Cc4ccccc14 | | CAS DataBase Reference | 2768-90-3(CAS DataBase Reference) | | EPA Substance Registry System | Quinolinium, 1-ethyl-2-[3-(1-ethyl-2(1H)-quinolinylidene)-1-propenyl]-, chloride (2768-90-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2933.49.7000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Pinacyanol chloride Usage And Synthesis |
| Description | Pinacyanol chloride is a water-soluble dichroic dye. | | Chemical Properties | OLIVE-GREEN TO GREEN-BLACK POWDER | | Uses | Histological stain (chromosomes). | | Biological Activity | Pinacyanol chloride (1, 1-diethyl-2, 2-carbocyanine chloride), also known as quinaldine blue or PIN, belongs to the class of symmetric trimethinecyanine dyes. It is widely used as a histological stain. Pinacyanol chloride is used in the study of bacterial polysaccharides. Pinacyanol chloride exposure induces respiratory immunogenicity. PIN has two absorption maximums at 605nm and 550nm, which are known asα and β bands respectively. | | Purification Methods | Crystallise the dye from EtOH/diethyl ether. The iodide [605-91-4] crystallises from MeOH or EtOH with m 298-299o(dec) . [Beilstein 23 H 320, 23 I 89, II 282, III/IV 2064, 23/10 V 129.] |
| | Pinacyanol chloride Preparation Products And Raw materials |
|