| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 9-Methyl-3-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole Basic information |
| Product Name: | 9-Methyl-3-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole | | Synonyms: | 9-Methyl-3-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole;N-Methylcarbazole-3-boronic acid pinacol ester;9-Methyl-9H-carbazole-3-boronic acid pinacol ester;9-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole;9H-Carbazole, 9-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;9-Methylcarbazole-3-boronicacidpinacolester,95%;9-Methyl-9H<;9-Methyl-9H-carbazole-3-boronic acid pinacol ester | | CAS: | 1217891-71-8 | | MF: | C19H22BNO2 | | MW: | 307.19 | | EINECS: | | | Product Categories: | | | Mol File: | 1217891-71-8.mol |  |
| | 9-Methyl-3-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole Chemical Properties |
| Melting point | 146-151°C | | form | Powder | | color | Pale brown | | InChI | 1S/C19H22BNO2/c1-18(2)19(3,4)23-20(22-18)13-10-11-17-15(12-13)14-8-6-7-9-16(14)21(17)5/h6-12H,1-5H3 | | InChIKey | AVCKYKVGQYBADD-UHFFFAOYSA-N | | SMILES | Cn1c2ccccc2c3cc(ccc13)B4OC(C)(C)C(C)(C)O4 |
| Hazard Codes | N | | Risk Statements | 52/53 | | Safety Statements | 61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | 9-Methyl-3-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole Usage And Synthesis |
| | 9-Methyl-3-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole Preparation Products And Raw materials |
|