|
|
| | Sulfapyridine-13C6 Basic information |
| Product Name: | Sulfapyridine-13C6 | | Synonyms: | Sulfapyridine-13C6;Sulfapyridine-(phenyl-13C6)
;13C6-Sulfapyridine;Sulfapyridine-(phenyl-13C6);Sulfapyridine 13C6 (phenyl 13C6) | | CAS: | 1228182-45-3 | | MF: | C11H11N3O2S | | MW: | 255.25 | | EINECS: | | | Product Categories: | | | Mol File: | 1228182-45-3.mol |  |
| | Sulfapyridine-13C6 Chemical Properties |
| density | 1.432±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | Major Application | clinical testing | | InChI | 1S/C11H11N3O2S/c12-9-4-6-10(7-5-9)17(15,16)14-11-3-1-2-8-13-11/h1-8H,12H2,(H,13,14)/i4+1,5+1,6+1,7+1,9+1,10+1 | | InChIKey | GECHUMIMRBOMGK-PXKSRZEUSA-N | | SMILES | N[13c]1[13cH][13cH][13c]([13cH][13cH]1)S(=O)(=O)Nc2ccccn2 |
| WGK Germany | 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Repr. 2 |
| | Sulfapyridine-13C6 Usage And Synthesis |
| Uses | Refer to the productμs Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| | Sulfapyridine-13C6 Preparation Products And Raw materials |
|