| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Trimethylsilylmethyl azide Basic information |
| | Trimethylsilylmethyl azide Chemical Properties |
| Boiling point | 92-95°C | | density | 0,87 g/cm3 | | refractive index | 1.4300 to 1.4340 | | Fp | 6°C | | solubility | Sol organic solvents; insol water. | | form | clear liquid | | color | Colorless to Yellow to Green | | Specific Gravity | 0.87 | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | InChI=1S/C4H11N3Si/c1-8(2,3)4-6-7-5/h4H2,1-3H3 | | InChIKey | HKBUFTCADGLKAS-UHFFFAOYSA-N | | SMILES | C(N=[N+]=[N-])[Si](C)(C)C |
| | Trimethylsilylmethyl azide Usage And Synthesis |
| Physical properties | bp 43 °C/43 mmHg; IR νmax 2100 cm1;
1H NMR (CDCl3) δ = 0.12 (s, 9H), 2.75 (s, 2H); MS m/z
129, 73. | | Uses | Trimethylsilylmethyl Azide is used in the amination of organometallic compounds; preparation of
heterocyclic compounds; precursor of azomethine ylide, reactant in Silylmethyl-Substituted Heterocumulenes and [3 + 2] Cycloaddition etc. | | Preparation | Obtained in high yield by reaction of
sodium azide and (chloromethyl)trimethylsilane in DMF or
HMPA at 80°C. | | Precautions | Trimethylsilylmethyl Azide is a useful, safe substitute for methyl azide, bp 20 °C, which is explosive. It is stable to temperatures of at least 120 °C and can be stored in a refrigerator for more than 6 months.
|
| | Trimethylsilylmethyl azide Preparation Products And Raw materials |
|