- Cnidicin
-
- $153.00
-
2026-07-27
- CAS:14348-21-1
- Purity: 99.49%
- Supply Ability: 10g
- cnidicin
-
- $9.80
-
2020-02-11
- CAS:14348-21-1
- Min. Order: 1g
- Purity: >98%
- Supply Ability: 20 tons
|
| | 4,9-Bis[(3-methyl-2-buten-1-yl)oxy]-7H-furo[3,2-g][1]benzopyran-7-one Basic information |
| Product Name: | 4,9-Bis[(3-methyl-2-buten-1-yl)oxy]-7H-furo[3,2-g][1]benzopyran-7-one | | Synonyms: | 4,9-Bis[(3-methyl-2-buten-1-yl)oxy]-7H-furo[3,2-g][1]benzopyran-7-one;kinidilin;7H-Furo[3,2-g][1]benzopyran-7-one,4,9-bis[(3-methyl-2-buten-1-yl)oxy]-;4,9-Bis((3-methylbut-2-en-1-yl)oxy)-7H-furo[3,2-g]chromen-7-one;Cnidicin,Inhibitor,inhibit;Cnidicin, 10 mM in DMSO | | CAS: | 14348-21-1 | | MF: | C21H22O5 | | MW: | 354.4 | | EINECS: | | | Product Categories: | | | Mol File: | 14348-21-1.mol | ![4,9-Bis[(3-methyl-2-buten-1-yl)oxy]-7H-furo[3,2-g][1]benzopyran-7-one Structure](CAS/20150408/GIF/14348-21-1.gif) |
| | 4,9-Bis[(3-methyl-2-buten-1-yl)oxy]-7H-furo[3,2-g][1]benzopyran-7-one Chemical Properties |
| Boiling point | 519.0±50.0 °C(Predicted) | | density | 1.177 | | storage temp. | -20°C | | form | Solid | | color | Off-white to light yellow | | InChI | 1S/C21H22O5/c1-13(2)7-10-23-18-15-5-6-17(22)26-20(15)21(25-11-8-14(3)4)19-16(18)9-12-24-19/h5-9,12H,10-11H2,1-4H3 | | InChIKey | HJMDOAWWVCOEDW-UHFFFAOYSA-N | | SMILES | [o]1c2c(c(c3c([o]cc3)c2OCC=C(C)C)OCC=C(C)C)cc[c]1=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4,9-Bis[(3-methyl-2-buten-1-yl)oxy]-7H-furo[3,2-g][1]benzopyran-7-one Usage And Synthesis |
| Uses | Cnidicin, a coumarin, inhibits the degranulation of mast cell and the nitric oxide (NO) generation in RAW 264.7 cells[1]. | | References | [1] Ryu SY, et al. Cnidicin, a coumarin, from the root of Angelica koreana, inhibits the degranulation of mast cell and the NO generation in RAW 264.7 cells. Planta Med. 2001 Mar;67(2):172-4. DOI:10.1055/s-2001-11509 |
| | 4,9-Bis[(3-methyl-2-buten-1-yl)oxy]-7H-furo[3,2-g][1]benzopyran-7-one Preparation Products And Raw materials |
|