|
|
| | (S)-tert-butyl 3-(4-aMinophenyl)piperidine-1-carboxylate Basic information | | Physical Form |
| Product Name: | (S)-tert-butyl 3-(4-aMinophenyl)piperidine-1-carboxylate | | Synonyms: | (S)-tert-butyl 3-(4-aMinophenyl)piperidine-1-carboxylate;tert-butyl (S)-3-(4-aminophenyl)piperidine-1-carboxylate;tert-butyl (3S)-3-(4-aminophenyl)piperidine-1-carboxylate;(3S)-3-(4-Aminophenyl)-1-piperidinecarboxylic acid 1,1-dimethylethyl ester;(3S)-3-(4-aminophenyl)piperidine-1-carboxylic acid tert-butyl ester;mk4827 int;MK4827 intermediate;1-Piperidinecarboxylic acid, 3-(4-aminophenyl)-, 1,1-dimethylethyl ester, (3S)- | | CAS: | 1171197-20-8 | | MF: | C16H24N2O2 | | MW: | 276.37 | | EINECS: | | | Product Categories: | 1171197-20-8 | | Mol File: | 1171197-20-8.mol |  |
| | (S)-tert-butyl 3-(4-aMinophenyl)piperidine-1-carboxylate Chemical Properties |
| Boiling point | 412.7±45.0 °C(Predicted) | | density | 1.100±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 4.96±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C16H24N2O2/c1-16(2,3)20-15(19)18-10-4-5-13(11-18)12-6-8-14(17)9-7-12/h6-9,13H,4-5,10-11,17H2,1-3H3/t13-/m1/s1 | | InChIKey | SWUANUQBXJNXGP-CYBMUJFWSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC[C@@H](C2=CC=C(N)C=C2)C1 |
| | (S)-tert-butyl 3-(4-aMinophenyl)piperidine-1-carboxylate Usage And Synthesis |
| Physical Form | Solid | | Uses | (S)-tert-Butyl 3-(4-Aminophenyl)piperidine-1-carboxylate is an impurity of Niraparib, a novel oral poly(ADP-ribose)polymerase (PARP) inhibitor efficacious in BRCA-1 and -2 mutant tumors. |
| | (S)-tert-butyl 3-(4-aMinophenyl)piperidine-1-carboxylate Preparation Products And Raw materials |
|