|
|
| | N-(tert-butyl)-1H-indazole-7-carboxamide Basic information | | 用途 |
| Product Name: | N-(tert-butyl)-1H-indazole-7-carboxamide | | Synonyms: | 1H-Indazole-7-carboxamide,N-(1,1-dimethylethyl)-;N-tert-Butyl-1H-indazole-7-carboxamide(WS203844);N-(1,1-dimethylethyl)-1H-Indazole-7-carboxamide;Reaxys ID: 26967775;N- tert-butyl-1 H- indazole-7-formamide;N-tert-b1H-indazole-7-carboxamide;RSYY(Vorapaxar Sulfatet)-13;N-(tert-butyl)-1H-indazole-7-carboxamide | | CAS: | 1476776-76-7 | | MF: | C12H15N3O | | MW: | 217.27 | | EINECS: | | | Product Categories: | API fragment | | Mol File: | 1476776-76-7.mol |  |
| | N-(tert-butyl)-1H-indazole-7-carboxamide Chemical Properties |
| Boiling point | 465.6±18.0 °C(Predicted) | | density | 1.174±0.06 g/cm3(Predicted) | | storage temp. | Store at 0-8 °C | | pka | 12.55±0.40(Predicted) | | Appearance | off-white solid | | InChI | InChI=1S/C12H15N3O/c1-12(2,3)14-11(16)9-6-4-5-8-7-13-15-10(8)9/h4-7H,1-3H3,(H,13,15)(H,14,16) | | InChIKey | WRDUXSGUYODZGR-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2C(NC(C)(C)C)=O)C=N1 |
| | N-(tert-butyl)-1H-indazole-7-carboxamide Usage And Synthesis |
| 用途 |
N-(tert-butyl)-1H-indazole-7-carboxamide is used as a Key intermediate in synthesis of kinase inhibitors and anticancer agents.
|
| | N-(tert-butyl)-1H-indazole-7-carboxamide Preparation Products And Raw materials |
|